C30H26ClFN4O6 — CID 87851432
[1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidin-4-yl] hydrogen carbonate (PubChem CID 87851432) has the molecular formula C30H26ClFN4O6 and a molecular weight of 593.01 g/mol. Its IUPAC name is [1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidin-4-yl] hydrogen carbonate.
| Compound Name | [1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 87851432 |
| Molecular Formula | C30H26ClFN4O6 |
| Molecular Weight | 593.01 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | [1-[[4-[[4-chloro-2-[(4-ethynylphenyl)carbamoyl]-6-methoxyphenyl]carbamoyl]-3-fluorophenyl]iminomethyl]piperidin-4-yl] hydrogen carbonate |
| SMILES | C#Cc1ccc(NC(=O)c2cc(Cl)cc(OC)c2NC(=O)c2ccc(/N=C/N3CCC(OC(=O)O)CC3)cc2F)cc1 |
| InChI | InChI=1S/C30H26ClFN4O6/c1-3-18-4-6-20(7-5-18)34-29(38)24-14-19(31)15-26(41-2)27(24)35-28(37)23-9-8-21(16-25(23)32)33-17-36-12-10-22(11-13-36)42-30(39)40/h1,4-9,14-17,22H,10-13H2,2H3,(H,34,38)(H,35,37)(H,39,40)/b33-17+ |
| InChIKey | AJYGUJNEJRTBQN-ATZGPIRCSA-N |
| XLogP | 5.79 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.01 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|