C29H27ClN6O4 — CID 87850436
1-[[4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-ethynyl-6-methoxyphenyl]carbamoyl]phenyl]iminomethyl]piperidine-4-carboxamide (PubChem CID 87850436) has the molecular formula C29H27ClN6O4 and a molecular weight of 559.03 g/mol. Its IUPAC name is 1-[[4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-ethynyl-6-methoxyphenyl]carbamoyl]phenyl]iminomethyl]piperidine-4-carboxamide.
| Compound Name | 1-[[4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-ethynyl-6-methoxyphenyl]carbamoyl]phenyl]iminomethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 87850436 |
| Molecular Formula | C29H27ClN6O4 |
| Molecular Weight | 559.03 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 1-[[4-[[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-ethynyl-6-methoxyphenyl]carbamoyl]phenyl]iminomethyl]piperidine-4-carboxamide |
| SMILES | C#Cc1cc(OC)c(NC(=O)c2ccc(/N=C/N3CCC(C(N)=O)CC3)cc2)c(C(=O)Nc2ccc(Cl)cn2)c1 |
| InChI | InChI=1S/C29H27ClN6O4/c1-3-18-14-23(29(39)34-25-9-6-21(30)16-32-25)26(24(15-18)40-2)35-28(38)20-4-7-22(8-5-20)33-17-36-12-10-19(11-13-36)27(31)37/h1,4-9,14-17,19H,10-13H2,2H3,(H2,31,37)(H,35,38)(H,32,34,39)/b33-17+ |
| InChIKey | HGKUCAPJKNGOHG-ATZGPIRCSA-N |
| XLogP | 4.09 |
| TPSA | 139.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.03 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|