C24H15ClFN3O3 — CID 59020977
5-chloro-N-(4-ethynylphenyl)-2-[(2-fluoro-4-isocyanobenzoyl)amino]-3-methoxybenzamide (PubChem CID 59020977) has the molecular formula C24H15ClFN3O3 and a molecular weight of 447.85 g/mol. Its IUPAC name is 5-chloro-N-(4-ethynylphenyl)-2-[(2-fluoro-4-isocyanobenzoyl)amino]-3-methoxybenzamide.
| Compound Name | 5-chloro-N-(4-ethynylphenyl)-2-[(2-fluoro-4-isocyanobenzoyl)amino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 59020977 |
| Molecular Formula | C24H15ClFN3O3 |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 5-chloro-N-(4-ethynylphenyl)-2-[(2-fluoro-4-isocyanobenzoyl)amino]-3-methoxybenzamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(C#C)cc2)c(F)c1 |
| InChI | InChI=1S/C24H15ClFN3O3/c1-4-14-5-7-16(8-6-14)28-24(31)19-11-15(25)12-21(32-3)22(19)29-23(30)18-10-9-17(27-2)13-20(18)26/h1,5-13H,3H3,(H,28,31)(H,29,30) |
| InChIKey | MNTMQJUDPZJRJB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|