C25H22Cl2FN3O2 — CID 158382670
2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)benzamide;methane (PubChem CID 158382670) has the molecular formula C25H22Cl2FN3O2 and a molecular weight of 486.37 g/mol. Its IUPAC name is 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)benzamide;methane.
| Compound Name | 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)benzamide;methane |
|---|---|
| PubChem CID | 158382670 |
| Molecular Formula | C25H22Cl2FN3O2 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(4-chlorophenyl)benzamide;methane |
| SMILES | C.[H]/N=C(/c1ccc(C(=O)Cc2ccc(Cl)cc2C(=O)Nc2ccc(Cl)cc2)c(F)c1)N1CC1 |
| InChI | InChI=1S/C24H18Cl2FN3O2.CH4/c25-16-4-6-18(7-5-16)29-24(32)20-13-17(26)3-1-14(20)12-22(31)19-8-2-15(11-21(19)27)23(28)30-9-10-30;/h1-8,11,13,28H,9-10,12H2,(H,29,32);1H4/b28-23-; |
| InChIKey | GVZHZUBXBNUPRG-MCOPDZHSSA-N |
| XLogP | 6.09 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|