C28H30ClN5O2 — CID 159566547
N-(5-chloro-2-pyridinyl)-5-(dimethylamino)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide (PubChem CID 159566547) has the molecular formula C28H30ClN5O2 and a molecular weight of 504.03 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-5-(dimethylamino)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-5-(dimethylamino)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 159566547 |
| Molecular Formula | C28H30ClN5O2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-5-(dimethylamino)-2-[2-oxo-2-[4-(piperidine-1-carboximidoyl)phenyl]ethyl]benzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2ccc(N(C)C)cc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C28H30ClN5O2/c1-33(2)23-12-10-21(24(17-23)28(36)32-26-13-11-22(29)18-31-26)16-25(35)19-6-8-20(9-7-19)27(30)34-14-4-3-5-15-34/h6-13,17-18,30H,3-5,14-16H2,1-2H3,(H,31,32,36)/b30-27- |
| InChIKey | XDZPHMIYLGOWJK-IKPAITLHSA-N |
| XLogP | 5.29 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|