C26H30ClN5O — CID 160520067
N-(5-chloro-2-pyridinyl)-2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]benzamide;methane (PubChem CID 160520067) has the molecular formula C26H30ClN5O and a molecular weight of 464.01 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]benzamide;methane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]benzamide;methane |
|---|---|
| PubChem CID | 160520067 |
| Molecular Formula | C26H30ClN5O |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]benzamide;methane |
| SMILES | C.[H]/N=C(/c1ccc(NCc2ccccc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H26ClN5O.CH4/c26-20-10-13-23(29-17-20)30-25(32)22-7-3-2-6-19(22)16-28-21-11-8-18(9-12-21)24(27)31-14-4-1-5-15-31;/h2-3,6-13,17,27-28H,1,4-5,14-16H2,(H,29,30,32);1H4/b27-24-; |
| InChIKey | QUDQNIZZGINFLA-XLKZBTFOSA-N |
| XLogP | 6.05 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|