C26H29ClN4OS — CID 159635718
N-(5-chloro-2-pyridinyl)-2-[2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]benzamide;methane (PubChem CID 159635718) has the molecular formula C26H29ClN4OS and a molecular weight of 481.07 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]benzamide;methane.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]benzamide;methane |
|---|---|
| PubChem CID | 159635718 |
| Molecular Formula | C26H29ClN4OS |
| Molecular Weight | 481.07 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[2-[4-(thiomorpholine-4-carboximidoyl)phenyl]ethyl]benzamide;methane |
| SMILES | C.[H]/N=C(/c1ccc(CCc2ccccc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCSCC1 |
| InChI | InChI=1S/C25H25ClN4OS.CH4/c26-21-11-12-23(28-17-21)29-25(31)22-4-2-1-3-19(22)8-5-18-6-9-20(10-7-18)24(27)30-13-15-32-16-14-30;/h1-4,6-7,9-12,17,27H,5,8,13-16H2,(H,28,29,31);1H4/b27-24-; |
| InChIKey | MPSGUAWFTWZKKR-XLKZBTFOSA-N |
| XLogP | 5.78 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.07 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|