C24H21BFN5O2S — CID 89305448
CID 89305448 (PubChem CID 89305448) has the molecular formula C24H21BFN5O2S and a molecular weight of 473.34 g/mol.
| Compound Name | CID 89305448 |
|---|---|
| PubChem CID | 89305448 |
| Molecular Formula | C24H21BFN5O2S |
| Molecular Weight | 473.34 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | — |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccccc2C(=O)Nc2ccc([B])cn2)c(F)c1)N1CCSCC1 |
| InChI | InChI=1S/C24H21BFN5O2S/c25-16-6-8-21(28-14-16)30-24(33)18-3-1-2-4-20(18)29-23(32)17-7-5-15(13-19(17)26)22(27)31-9-11-34-12-10-31/h1-8,13-14,27H,9-12H2,(H,29,32)(H,28,30,33)/b27-22- |
| InChIKey | WHTAIPCIVKFWJX-QYQHSDTDSA-N |
| XLogP | 2.89 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|