C25H22BF2N5O2 — CID 89063515
CID 89063515 (PubChem CID 89063515) has the molecular formula C25H22BF2N5O2 and a molecular weight of 473.29 g/mol.
| Compound Name | CID 89063515 |
|---|---|
| PubChem CID | 89063515 |
| Molecular Formula | C25H22BF2N5O2 |
| Molecular Weight | 473.29 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | — |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2cc(F)c(F)cc2C(=O)Nc2ccc([B])cn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C25H22BF2N5O2/c26-17-8-9-22(30-14-17)32-25(35)18-12-19(27)20(28)13-21(18)31-24(34)16-6-4-15(5-7-16)23(29)33-10-2-1-3-11-33/h4-9,12-14,29H,1-3,10-11H2,(H,31,34)(H,30,32,35)/b29-23- |
| InChIKey | MLMODJGXUUTOFW-FAJYDZGRSA-N |
| XLogP | 3.47 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|