C28H29ClN4O — CID 142083527
3-(5-chloro-2-pyridinyl)-1-[2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]phenyl]but-3-en-1-one (PubChem CID 142083527) has the molecular formula C28H29ClN4O and a molecular weight of 473.02 g/mol. Its IUPAC name is 3-(5-chloro-2-pyridinyl)-1-[2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]phenyl]but-3-en-1-one.
| Compound Name | 3-(5-chloro-2-pyridinyl)-1-[2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]phenyl]but-3-en-1-one |
|---|---|
| PubChem CID | 142083527 |
| Molecular Formula | C28H29ClN4O |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 3-(5-chloro-2-pyridinyl)-1-[2-[[4-(piperidine-1-carboximidoyl)anilino]methyl]phenyl]but-3-en-1-one |
| SMILES | [H]/N=C(/c1ccc(NCc2ccccc2C(=O)CC(=C)c2ccc(Cl)cn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C28H29ClN4O/c1-20(26-14-11-23(29)19-32-26)17-27(34)25-8-4-3-7-22(25)18-31-24-12-9-21(10-13-24)28(30)33-15-5-2-6-16-33/h3-4,7-14,19,30-31H,1-2,5-6,15-18H2/b30-28- |
| InChIKey | DRZQKSPZNGBFAF-HYOGKJQXSA-N |
| XLogP | 6.44 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|