C23H16ClN3O2 — CID 142175051
acetylene;2-benzamido-5-chloro-N-(5-ethynyl-2-pyridinyl)benzamide (PubChem CID 142175051) has the molecular formula C23H16ClN3O2 and a molecular weight of 401.85 g/mol. Its IUPAC name is acetylene;2-benzamido-5-chloro-N-(5-ethynyl-2-pyridinyl)benzamide.
| Compound Name | acetylene;2-benzamido-5-chloro-N-(5-ethynyl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 142175051 |
| Molecular Formula | C23H16ClN3O2 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | acetylene;2-benzamido-5-chloro-N-(5-ethynyl-2-pyridinyl)benzamide |
| SMILES | C#C.C#Cc1ccc(NC(=O)c2cc(Cl)ccc2NC(=O)c2ccccc2)nc1 |
| InChI | InChI=1S/C21H14ClN3O2.C2H2/c1-2-14-8-11-19(23-13-14)25-21(27)17-12-16(22)9-10-18(17)24-20(26)15-6-4-3-5-7-15;1-2/h1,3-13H,(H,24,26)(H,23,25,27);1-2H |
| InChIKey | PXHOTOMZBVFXAE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|