C18H20ClN3O2Si — CID 59020763
2-amino-N-(5-chloro-2-pyridinyl)-3-methoxy-5-(2-trimethylsilylethynyl)benzamide (PubChem CID 59020763) has the molecular formula C18H20ClN3O2Si and a molecular weight of 373.92 g/mol. Its IUPAC name is 2-amino-N-(5-chloro-2-pyridinyl)-3-methoxy-5-(2-trimethylsilylethynyl)benzamide.
| Compound Name | 2-amino-N-(5-chloro-2-pyridinyl)-3-methoxy-5-(2-trimethylsilylethynyl)benzamide |
|---|---|
| PubChem CID | 59020763 |
| Molecular Formula | C18H20ClN3O2Si |
| Molecular Weight | 373.92 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-amino-N-(5-chloro-2-pyridinyl)-3-methoxy-5-(2-trimethylsilylethynyl)benzamide |
| SMILES | COc1cc(C#C[Si](C)(C)C)cc(C(=O)Nc2ccc(Cl)cn2)c1N |
| InChI | InChI=1S/C18H20ClN3O2Si/c1-24-15-10-12(7-8-25(2,3)4)9-14(17(15)20)18(23)22-16-6-5-13(19)11-21-16/h5-6,9-11H,20H2,1-4H3,(H,21,22,23) |
| InChIKey | YEIDCAJNXJJZSA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|