C18H19ClN2OSi — CID 59020997
2-amino-N-(4-chlorophenyl)-5-(2-trimethylsilylethynyl)benzamide (PubChem CID 59020997) has the molecular formula C18H19ClN2OSi and a molecular weight of 342.90 g/mol. Its IUPAC name is 2-amino-N-(4-chlorophenyl)-5-(2-trimethylsilylethynyl)benzamide.
| Compound Name | 2-amino-N-(4-chlorophenyl)-5-(2-trimethylsilylethynyl)benzamide |
|---|---|
| PubChem CID | 59020997 |
| Molecular Formula | C18H19ClN2OSi |
| Molecular Weight | 342.90 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-amino-N-(4-chlorophenyl)-5-(2-trimethylsilylethynyl)benzamide |
| SMILES | C[Si](C)(C)C#Cc1ccc(N)c(C(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H19ClN2OSi/c1-23(2,3)11-10-13-4-9-17(20)16(12-13)18(22)21-15-7-5-14(19)6-8-15/h4-9,12H,20H2,1-3H3,(H,21,22) |
| InChIKey | UZFBWVOFXWVDPA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|