C25H25ClN2OSi — CID 67314508
[4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-(2-trimethylsilylethynyl)phenyl]methanone (PubChem CID 67314508) has the molecular formula C25H25ClN2OSi and a molecular weight of 433.03 g/mol. Its IUPAC name is [4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-(2-trimethylsilylethynyl)phenyl]methanone.
| Compound Name | [4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-(2-trimethylsilylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 67314508 |
| Molecular Formula | C25H25ClN2OSi |
| Molecular Weight | 433.03 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | [4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-(2-trimethylsilylethynyl)phenyl]methanone |
| SMILES | Cc1ccc(C#C[Si](C)(C)C)cc1C(=O)c1ccc(Nc2ccccc2N)cc1Cl |
| InChI | InChI=1S/C25H25ClN2OSi/c1-17-9-10-18(13-14-30(2,3)4)15-21(17)25(29)20-12-11-19(16-22(20)26)28-24-8-6-5-7-23(24)27/h5-12,15-16,28H,27H2,1-4H3 |
| InChIKey | RILGMBMHXWQETN-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.03 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|