C20H16BrClN2O — CID 22480519
[4-(2-amino-5-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone (PubChem CID 22480519) has the molecular formula C20H16BrClN2O and a molecular weight of 415.72 g/mol. Its IUPAC name is [4-(2-amino-5-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone.
| Compound Name | [4-(2-amino-5-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 22480519 |
| Molecular Formula | C20H16BrClN2O |
| Molecular Weight | 415.72 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | [4-(2-amino-5-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1ccc(Nc2cc(Br)ccc2N)cc1Cl |
| InChI | InChI=1S/C20H16BrClN2O/c1-12-4-2-3-5-15(12)20(25)16-8-7-14(11-17(16)22)24-19-10-13(21)6-9-18(19)23/h2-11,24H,23H2,1H3 |
| InChIKey | ZMFIGSGRLLSBKE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|