C20H15BrClNO — CID 10201018
[4-(4-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone (PubChem CID 10201018) has the molecular formula C20H15BrClNO and a molecular weight of 400.70 g/mol. Its IUPAC name is [4-(4-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone.
| Compound Name | [4-(4-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 10201018 |
| Molecular Formula | C20H15BrClNO |
| Molecular Weight | 400.70 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | [4-(4-bromoanilino)-2-chlorophenyl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1ccc(Nc2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C20H15BrClNO/c1-13-4-2-3-5-17(13)20(24)18-11-10-16(12-19(18)22)23-15-8-6-14(21)7-9-15/h2-12,23H,1H3 |
| InChIKey | NHDUNYNBPYSAGE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.70 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |