C30H33BrClN3O4 — CID 22174482
N'-[5-bromo-2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-N-(6-hydroxyhexyl)butanediamide (PubChem CID 22174482) has the molecular formula C30H33BrClN3O4 and a molecular weight of 614.97 g/mol. Its IUPAC name is N'-[5-bromo-2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-N-(6-hydroxyhexyl)butanediamide.
| Compound Name | N'-[5-bromo-2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-N-(6-hydroxyhexyl)butanediamide |
|---|---|
| PubChem CID | 22174482 |
| Molecular Formula | C30H33BrClN3O4 |
| Molecular Weight | 614.97 g/mol |
| Exact Mass | 613.13 |
| IUPAC Name | N'-[5-bromo-2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-N-(6-hydroxyhexyl)butanediamide |
| SMILES | Cc1ccccc1C(=O)c1ccc(Nc2ccc(Br)cc2NC(=O)CCC(=O)NCCCCCCO)cc1Cl |
| InChI | InChI=1S/C30H33BrClN3O4/c1-20-8-4-5-9-23(20)30(39)24-12-11-22(19-25(24)32)34-26-13-10-21(31)18-27(26)35-29(38)15-14-28(37)33-16-6-2-3-7-17-36/h4-5,8-13,18-19,34,36H,2-3,6-7,14-17H2,1H3,(H,33,37)(H,35,38) |
| InChIKey | XGXYMJHEYXZLMP-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.97 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|