C25H26ClNO4 — CID 10203602
[2-chloro-4-[2-[2-(2-hydroxyethoxy)ethoxymethyl]anilino]phenyl]-(2-methylphenyl)methanone (PubChem CID 10203602) has the molecular formula C25H26ClNO4 and a molecular weight of 439.94 g/mol. Its IUPAC name is [2-chloro-4-[2-[2-(2-hydroxyethoxy)ethoxymethyl]anilino]phenyl]-(2-methylphenyl)methanone.
| Compound Name | [2-chloro-4-[2-[2-(2-hydroxyethoxy)ethoxymethyl]anilino]phenyl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 10203602 |
| Molecular Formula | C25H26ClNO4 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [2-chloro-4-[2-[2-(2-hydroxyethoxy)ethoxymethyl]anilino]phenyl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1ccc(Nc2ccccc2COCCOCCO)cc1Cl |
| InChI | InChI=1S/C25H26ClNO4/c1-18-6-2-4-8-21(18)25(29)22-11-10-20(16-23(22)26)27-24-9-5-3-7-19(24)17-31-15-14-30-13-12-28/h2-11,16,27-28H,12-15,17H2,1H3 |
| InChIKey | PDIPQSUMQLMPMJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|