C22H17ClF3NO2 — CID 11235486
[2-chloro-4-[2-methyl-4-(trifluoromethoxy)anilino]phenyl]-(2-methylphenyl)methanone (PubChem CID 11235486) has the molecular formula C22H17ClF3NO2 and a molecular weight of 419.83 g/mol. Its IUPAC name is [2-chloro-4-[2-methyl-4-(trifluoromethoxy)anilino]phenyl]-(2-methylphenyl)methanone.
| Compound Name | [2-chloro-4-[2-methyl-4-(trifluoromethoxy)anilino]phenyl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 11235486 |
| Molecular Formula | C22H17ClF3NO2 |
| Molecular Weight | 419.83 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | [2-chloro-4-[2-methyl-4-(trifluoromethoxy)anilino]phenyl]-(2-methylphenyl)methanone |
| SMILES | Cc1cc(OC(F)(F)F)ccc1Nc1ccc(C(=O)c2ccccc2C)c(Cl)c1 |
| InChI | InChI=1S/C22H17ClF3NO2/c1-13-5-3-4-6-17(13)21(28)18-9-7-15(12-19(18)23)27-20-10-8-16(11-14(20)2)29-22(24,25)26/h3-12,27H,1-2H3 |
| InChIKey | GZBJRLCJOSEBTR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.83 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |