C24H24ClNO3 — CID 22174459
[2-chloro-4-[2-(1-hydroxypropoxymethyl)anilino]phenyl]-(2-methylphenyl)methanone (PubChem CID 22174459) has the molecular formula C24H24ClNO3 and a molecular weight of 409.91 g/mol. Its IUPAC name is [2-chloro-4-[2-(1-hydroxypropoxymethyl)anilino]phenyl]-(2-methylphenyl)methanone.
| Compound Name | [2-chloro-4-[2-(1-hydroxypropoxymethyl)anilino]phenyl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 22174459 |
| Molecular Formula | C24H24ClNO3 |
| Molecular Weight | 409.91 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [2-chloro-4-[2-(1-hydroxypropoxymethyl)anilino]phenyl]-(2-methylphenyl)methanone |
| SMILES | CCC(O)OCc1ccccc1Nc1ccc(C(=O)c2ccccc2C)c(Cl)c1 |
| InChI | InChI=1S/C24H24ClNO3/c1-3-23(27)29-15-17-9-5-7-11-22(17)26-18-12-13-20(21(25)14-18)24(28)19-10-6-4-8-16(19)2/h4-14,23,26-27H,3,15H2,1-2H3 |
| InChIKey | DKJIUJHTNBFOHT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.91 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|