C21H16ClF2NO — CID 22174560
[2-chloro-4-[2-(difluoromethyl)anilino]phenyl]-(2-methylphenyl)methanone (PubChem CID 22174560) has the molecular formula C21H16ClF2NO and a molecular weight of 371.81 g/mol. Its IUPAC name is [2-chloro-4-[2-(difluoromethyl)anilino]phenyl]-(2-methylphenyl)methanone.
| Compound Name | [2-chloro-4-[2-(difluoromethyl)anilino]phenyl]-(2-methylphenyl)methanone |
|---|---|
| PubChem CID | 22174560 |
| Molecular Formula | C21H16ClF2NO |
| Molecular Weight | 371.81 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [2-chloro-4-[2-(difluoromethyl)anilino]phenyl]-(2-methylphenyl)methanone |
| SMILES | Cc1ccccc1C(=O)c1ccc(Nc2ccccc2C(F)F)cc1Cl |
| InChI | InChI=1S/C21H16ClF2NO/c1-13-6-2-3-7-15(13)20(26)16-11-10-14(12-18(16)22)25-19-9-5-4-8-17(19)21(23)24/h2-12,21,25H,1H3 |
| InChIKey | PVYCUEDTOJBESW-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.81 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |