C29H31ClN2O6 — CID 174474099
4-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]imino-4-ethoxy-2-(2-methoxyethoxy)butanoic acid (PubChem CID 174474099) has the molecular formula C29H31ClN2O6 and a molecular weight of 539.03 g/mol. Its IUPAC name is 4-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]imino-4-ethoxy-2-(2-methoxyethoxy)butanoic acid.
| Compound Name | 4-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]imino-4-ethoxy-2-(2-methoxyethoxy)butanoic acid |
|---|---|
| PubChem CID | 174474099 |
| Molecular Formula | C29H31ClN2O6 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 4-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]imino-4-ethoxy-2-(2-methoxyethoxy)butanoic acid |
| SMILES | CCO/C(CC(OCCOC)C(=O)O)=N/c1ccccc1Nc1ccc(C(=O)c2ccccc2C)c(Cl)c1 |
| InChI | InChI=1S/C29H31ClN2O6/c1-4-37-27(18-26(29(34)35)38-16-15-36-3)32-25-12-8-7-11-24(25)31-20-13-14-22(23(30)17-20)28(33)21-10-6-5-9-19(21)2/h5-14,17,26,31H,4,15-16,18H2,1-3H3,(H,34,35)/b32-27+ |
| InChIKey | PVDLAJIIKWDSSM-QVAGMWBUSA-N |
| XLogP | 6.20 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|