C34H31ClN2O7 — CID 22480515
1-O-benzyl 4-O-[1-[[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]carbamoyloxy]ethyl] butanedioate (PubChem CID 22480515) has the molecular formula C34H31ClN2O7 and a molecular weight of 615.08 g/mol. Its IUPAC name is 1-O-benzyl 4-O-[1-[[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]carbamoyloxy]ethyl] butanedioate.
| Compound Name | 1-O-benzyl 4-O-[1-[[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]carbamoyloxy]ethyl] butanedioate |
|---|---|
| PubChem CID | 22480515 |
| Molecular Formula | C34H31ClN2O7 |
| Molecular Weight | 615.08 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | 1-O-benzyl 4-O-[1-[[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]carbamoyloxy]ethyl] butanedioate |
| SMILES | Cc1ccccc1C(=O)c1ccc(Nc2ccccc2NC(=O)OC(C)OC(=O)CCC(=O)OCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C34H31ClN2O7/c1-22-10-6-7-13-26(22)33(40)27-17-16-25(20-28(27)35)36-29-14-8-9-15-30(29)37-34(41)44-23(2)43-32(39)19-18-31(38)42-21-24-11-4-3-5-12-24/h3-17,20,23,36H,18-19,21H2,1-2H3,(H,37,41) |
| InChIKey | KSHAHOXYEICJSX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.08 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|