C27H26ClNO5S — CID 90729834
methyl 5-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-2-methylsulfonylpent-4-enoate (PubChem CID 90729834) has the molecular formula C27H26ClNO5S and a molecular weight of 512.03 g/mol. Its IUPAC name is methyl 5-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-2-methylsulfonylpent-4-enoate.
| Compound Name | methyl 5-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-2-methylsulfonylpent-4-enoate |
|---|---|
| PubChem CID | 90729834 |
| Molecular Formula | C27H26ClNO5S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | methyl 5-[2-[3-chloro-4-(2-methylbenzoyl)anilino]phenyl]-2-methylsulfonylpent-4-enoate |
| SMILES | COC(=O)C(CC=Cc1ccccc1Nc1ccc(C(=O)c2ccccc2C)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C27H26ClNO5S/c1-18-9-4-6-12-21(18)26(30)22-16-15-20(17-23(22)28)29-24-13-7-5-10-19(24)11-8-14-25(27(31)34-2)35(3,32)33/h4-13,15-17,25,29H,14H2,1-3H3 |
| InChIKey | LGPXUNKFCUOJIW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |