C23H21BrClNO2 — CID 69341741
[4-(3-bromo-2-methylanilino)-2-chlorophenyl]-(4-ethoxy-2-methylphenyl)methanone (PubChem CID 69341741) has the molecular formula C23H21BrClNO2 and a molecular weight of 458.78 g/mol. Its IUPAC name is [4-(3-bromo-2-methylanilino)-2-chlorophenyl]-(4-ethoxy-2-methylphenyl)methanone.
| Compound Name | [4-(3-bromo-2-methylanilino)-2-chlorophenyl]-(4-ethoxy-2-methylphenyl)methanone |
|---|---|
| PubChem CID | 69341741 |
| Molecular Formula | C23H21BrClNO2 |
| Molecular Weight | 458.78 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | [4-(3-bromo-2-methylanilino)-2-chlorophenyl]-(4-ethoxy-2-methylphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)c2ccc(Nc3cccc(Br)c3C)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C23H21BrClNO2/c1-4-28-17-9-11-18(14(2)12-17)23(27)19-10-8-16(13-21(19)25)26-22-7-5-6-20(24)15(22)3/h5-13,26H,4H2,1-3H3 |
| InChIKey | GELHUBBOVXOCTL-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |