C23H20BrClN2O2 — CID 58677525
[4-(2-amino-4-bromoanilino)-2-chlorophenyl]-(2-methyl-4-prop-2-enoxyphenyl)methanone (PubChem CID 58677525) has the molecular formula C23H20BrClN2O2 and a molecular weight of 471.78 g/mol. Its IUPAC name is [4-(2-amino-4-bromoanilino)-2-chlorophenyl]-(2-methyl-4-prop-2-enoxyphenyl)methanone.
| Compound Name | [4-(2-amino-4-bromoanilino)-2-chlorophenyl]-(2-methyl-4-prop-2-enoxyphenyl)methanone |
|---|---|
| PubChem CID | 58677525 |
| Molecular Formula | C23H20BrClN2O2 |
| Molecular Weight | 471.78 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | [4-(2-amino-4-bromoanilino)-2-chlorophenyl]-(2-methyl-4-prop-2-enoxyphenyl)methanone |
| SMILES | C=CCOc1ccc(C(=O)c2ccc(Nc3ccc(Br)cc3N)cc2Cl)c(C)c1 |
| InChI | InChI=1S/C23H20BrClN2O2/c1-3-10-29-17-6-8-18(14(2)11-17)23(28)19-7-5-16(13-20(19)25)27-22-9-4-15(24)12-21(22)26/h3-9,11-13,27H,1,10,26H2,2H3 |
| InChIKey | NBPFWQAVDLZYOP-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.78 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|