C28H29BrClNO4 — CID 58677507
[4-(4-bromo-2-methylanilino)-2-chlorophenyl]-[2-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methanone (PubChem CID 58677507) has the molecular formula C28H29BrClNO4 and a molecular weight of 558.90 g/mol. Its IUPAC name is [4-(4-bromo-2-methylanilino)-2-chlorophenyl]-[2-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methanone.
| Compound Name | [4-(4-bromo-2-methylanilino)-2-chlorophenyl]-[2-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 58677507 |
| Molecular Formula | C28H29BrClNO4 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | [4-(4-bromo-2-methylanilino)-2-chlorophenyl]-[2-methyl-4-[2-(oxan-2-yloxy)ethoxy]phenyl]methanone |
| SMILES | Cc1cc(Br)ccc1Nc1ccc(C(=O)c2ccc(OCCOC3CCCCO3)cc2C)c(Cl)c1 |
| InChI | InChI=1S/C28H29BrClNO4/c1-18-16-22(33-13-14-35-27-5-3-4-12-34-27)8-10-23(18)28(32)24-9-7-21(17-25(24)30)31-26-11-6-20(29)15-19(26)2/h6-11,15-17,27,31H,3-5,12-14H2,1-2H3 |
| InChIKey | AOACBFXEGYRILF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|