C29H30ClN5O3 — CID 11785901
[4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-[1-[2-(oxan-2-yloxy)ethyl]triazol-4-yl]phenyl]methanone (PubChem CID 11785901) has the molecular formula C29H30ClN5O3 and a molecular weight of 532.04 g/mol. Its IUPAC name is [4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-[1-[2-(oxan-2-yloxy)ethyl]triazol-4-yl]phenyl]methanone.
| Compound Name | [4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-[1-[2-(oxan-2-yloxy)ethyl]triazol-4-yl]phenyl]methanone |
|---|---|
| PubChem CID | 11785901 |
| Molecular Formula | C29H30ClN5O3 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | [4-(2-aminoanilino)-2-chlorophenyl]-[2-methyl-5-[1-[2-(oxan-2-yloxy)ethyl]triazol-4-yl]phenyl]methanone |
| SMILES | Cc1ccc(-c2cn(CCOC3CCCCO3)nn2)cc1C(=O)c1ccc(Nc2ccccc2N)cc1Cl |
| InChI | InChI=1S/C29H30ClN5O3/c1-19-9-10-20(27-18-35(34-33-27)13-15-38-28-8-4-5-14-37-28)16-23(19)29(36)22-12-11-21(17-24(22)30)32-26-7-3-2-6-25(26)31/h2-3,6-7,9-12,16-18,28,32H,4-5,8,13-15,31H2,1H3 |
| InChIKey | BIFMZZUPJUPFPK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|