C22H19BrClNO2 — CID 142756486
[4-[4-bromo-2-(2-hydroxyethyl)anilino]-2-methylphenyl]-(2-chlorophenyl)methanone (PubChem CID 142756486) has the molecular formula C22H19BrClNO2 and a molecular weight of 444.76 g/mol. Its IUPAC name is [4-[4-bromo-2-(2-hydroxyethyl)anilino]-2-methylphenyl]-(2-chlorophenyl)methanone.
| Compound Name | [4-[4-bromo-2-(2-hydroxyethyl)anilino]-2-methylphenyl]-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 142756486 |
| Molecular Formula | C22H19BrClNO2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | [4-[4-bromo-2-(2-hydroxyethyl)anilino]-2-methylphenyl]-(2-chlorophenyl)methanone |
| SMILES | Cc1cc(Nc2ccc(Br)cc2CCO)ccc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C22H19BrClNO2/c1-14-12-17(25-21-9-6-16(23)13-15(21)10-11-26)7-8-18(14)22(27)19-4-2-3-5-20(19)24/h2-9,12-13,25-26H,10-11H2,1H3 |
| InChIKey | PKHRYWBYUKQKDE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |