C13H7Br2ClO — CID 107944284
(2-chlorophenyl)-(2,4-dibromophenyl)methanone (PubChem CID 107944284) has the molecular formula C13H7Br2ClO and a molecular weight of 374.46 g/mol. Its IUPAC name is (2-chlorophenyl)-(2,4-dibromophenyl)methanone.
| Compound Name | (2-chlorophenyl)-(2,4-dibromophenyl)methanone |
|---|---|
| PubChem CID | 107944284 |
| Molecular Formula | C13H7Br2ClO |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 371.86 |
| IUPAC Name | (2-chlorophenyl)-(2,4-dibromophenyl)methanone |
| SMILES | O=C(c1ccccc1Cl)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H7Br2ClO/c14-8-5-6-9(11(15)7-8)13(17)10-3-1-2-4-12(10)16/h1-7H |
| InChIKey | JYERHLGLKZVOKI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |