C13H6Br2Cl2O — CID 107944424
(2,4-dibromophenyl)-(2,3-dichlorophenyl)methanone (PubChem CID 107944424) has the molecular formula C13H6Br2Cl2O and a molecular weight of 408.90 g/mol. Its IUPAC name is (2,4-dibromophenyl)-(2,3-dichlorophenyl)methanone.
| Compound Name | (2,4-dibromophenyl)-(2,3-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 107944424 |
| Molecular Formula | C13H6Br2Cl2O |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 405.82 |
| IUPAC Name | (2,4-dibromophenyl)-(2,3-dichlorophenyl)methanone |
| SMILES | O=C(c1ccc(Br)cc1Br)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H6Br2Cl2O/c14-7-4-5-8(10(15)6-7)13(18)9-2-1-3-11(16)12(9)17/h1-6H |
| InChIKey | VNMIHRJVCWHJMP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |