C22H17ClFNO3 — CID 58677585
3-[2-chloro-4-(3-fluoro-2-methylanilino)benzoyl]-4-methylbenzoic acid (PubChem CID 58677585) has the molecular formula C22H17ClFNO3 and a molecular weight of 397.83 g/mol. Its IUPAC name is 3-[2-chloro-4-(3-fluoro-2-methylanilino)benzoyl]-4-methylbenzoic acid.
| Compound Name | 3-[2-chloro-4-(3-fluoro-2-methylanilino)benzoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 58677585 |
| Molecular Formula | C22H17ClFNO3 |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 3-[2-chloro-4-(3-fluoro-2-methylanilino)benzoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1C(=O)c1ccc(Nc2cccc(F)c2C)cc1Cl |
| InChI | InChI=1S/C22H17ClFNO3/c1-12-6-7-14(22(27)28)10-17(12)21(26)16-9-8-15(11-18(16)23)25-20-5-3-4-19(24)13(20)2/h3-11,25H,1-2H3,(H,27,28) |
| InChIKey | DUMSEQQNCDJQNT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |