C27H19ClF2N2O2 — CID 141106486
3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methyl-N-phenylbenzamide (PubChem CID 141106486) has the molecular formula C27H19ClF2N2O2 and a molecular weight of 476.91 g/mol. Its IUPAC name is 3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methyl-N-phenylbenzamide.
| Compound Name | 3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 141106486 |
| Molecular Formula | C27H19ClF2N2O2 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methyl-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1C(=O)c1ccc(Nc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C27H19ClF2N2O2/c1-16-7-8-17(27(34)32-19-5-3-2-4-6-19)13-22(16)26(33)21-11-10-20(15-23(21)28)31-25-12-9-18(29)14-24(25)30/h2-15,31H,1H3,(H,32,34) |
| InChIKey | JVNAZRJUMQAXPN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |