C22H16Cl2F2N2O3 — CID 58677556
4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-N-(2-hydroxyethyl)benzamide (PubChem CID 58677556) has the molecular formula C22H16Cl2F2N2O3 and a molecular weight of 465.28 g/mol. Its IUPAC name is 4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 58677556 |
| Molecular Formula | C22H16Cl2F2N2O3 |
| Molecular Weight | 465.28 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(NCCO)c1ccc(Cl)c(C(=O)c2ccc(Nc3ccc(F)cc3F)cc2Cl)c1 |
| InChI | InChI=1S/C22H16Cl2F2N2O3/c23-17-5-1-12(22(31)27-7-8-29)9-16(17)21(30)15-4-3-14(11-18(15)24)28-20-6-2-13(25)10-19(20)26/h1-6,9-11,28-29H,7-8H2,(H,27,31) |
| InChIKey | QCBUCVKVOCQGHV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.28 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |