C28H21ClF2N2O2 — CID 11409234
N-benzyl-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylbenzamide (PubChem CID 11409234) has the molecular formula C28H21ClF2N2O2 and a molecular weight of 490.94 g/mol. Its IUPAC name is N-benzyl-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylbenzamide.
| Compound Name | N-benzyl-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11409234 |
| Molecular Formula | C28H21ClF2N2O2 |
| Molecular Weight | 490.94 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | N-benzyl-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccccc2)cc1C(=O)c1ccc(Nc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C28H21ClF2N2O2/c1-17-7-8-19(28(35)32-16-18-5-3-2-4-6-18)13-23(17)27(34)22-11-10-21(15-24(22)29)33-26-12-9-20(30)14-25(26)31/h2-15,33H,16H2,1H3,(H,32,35) |
| InChIKey | GHMCXZLCSZYOTP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.94 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |