C27H26ClF2N3O2 — CID 11167908
1-[3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylphenyl]-3-cyclohexylurea (PubChem CID 11167908) has the molecular formula C27H26ClF2N3O2 and a molecular weight of 497.97 g/mol. Its IUPAC name is 1-[3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylphenyl]-3-cyclohexylurea.
| Compound Name | 1-[3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylphenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 11167908 |
| Molecular Formula | C27H26ClF2N3O2 |
| Molecular Weight | 497.97 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 1-[3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-methylphenyl]-3-cyclohexylurea |
| SMILES | Cc1ccc(NC(=O)NC2CCCCC2)cc1C(=O)c1ccc(Nc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C27H26ClF2N3O2/c1-16-7-9-19(33-27(35)32-18-5-3-2-4-6-18)14-22(16)26(34)21-11-10-20(15-23(21)28)31-25-12-8-17(29)13-24(25)30/h7-15,18,31H,2-6H2,1H3,(H2,32,33,35) |
| InChIKey | DXGHYSHCFFXHIW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.97 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |