C24H22ClF2N3O2 — CID 143241599
[5-[(Z)-1-amino-2-(2-hydroxyethylamino)ethenyl]-2-methylphenyl]-[2-chloro-4-(2,4-difluoroanilino)phenyl]methanone (PubChem CID 143241599) has the molecular formula C24H22ClF2N3O2 and a molecular weight of 457.91 g/mol. Its IUPAC name is [5-[(Z)-1-amino-2-(2-hydroxyethylamino)ethenyl]-2-methylphenyl]-[2-chloro-4-(2,4-difluoroanilino)phenyl]methanone.
| Compound Name | [5-[(Z)-1-amino-2-(2-hydroxyethylamino)ethenyl]-2-methylphenyl]-[2-chloro-4-(2,4-difluoroanilino)phenyl]methanone |
|---|---|
| PubChem CID | 143241599 |
| Molecular Formula | C24H22ClF2N3O2 |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | [5-[(Z)-1-amino-2-(2-hydroxyethylamino)ethenyl]-2-methylphenyl]-[2-chloro-4-(2,4-difluoroanilino)phenyl]methanone |
| SMILES | Cc1ccc(/C(N)=C/NCCO)cc1C(=O)c1ccc(Nc2ccc(F)cc2F)cc1Cl |
| InChI | InChI=1S/C24H22ClF2N3O2/c1-14-2-3-15(22(28)13-29-8-9-31)10-19(14)24(32)18-6-5-17(12-20(18)25)30-23-7-4-16(26)11-21(23)27/h2-7,10-13,29-31H,8-9,28H2,1H3/b22-13- |
| InChIKey | WLAHPFUBUXUWOJ-XKZIYDEJSA-N |
| XLogP | 4.74 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|