C22H18Cl2F2N2O3 — CID 67314035
4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-(2-hydroxyethyl)cyclohexa-2,5-diene-1-carboxamide (PubChem CID 67314035) has the molecular formula C22H18Cl2F2N2O3 and a molecular weight of 467.30 g/mol. Its IUPAC name is 4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-(2-hydroxyethyl)cyclohexa-2,5-diene-1-carboxamide.
| Compound Name | 4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-(2-hydroxyethyl)cyclohexa-2,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 67314035 |
| Molecular Formula | C22H18Cl2F2N2O3 |
| Molecular Weight | 467.30 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 4-chloro-3-[2-chloro-4-(2,4-difluoroanilino)benzoyl]-4-(2-hydroxyethyl)cyclohexa-2,5-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC(Cl)(CCO)C(C(=O)c2ccc(Nc3ccc(F)cc3F)cc2Cl)=C1 |
| InChI | InChI=1S/C22H18Cl2F2N2O3/c23-17-11-14(28-19-4-1-13(25)10-18(19)26)2-3-15(17)20(30)16-9-12(21(27)31)5-6-22(16,24)7-8-29/h1-6,9-12,28-29H,7-8H2,(H2,27,31) |
| InChIKey | JXHNWIBZGAZTIP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|