C13H9F2NO2 — CID 62230863
4-(2,3-difluoroanilino)benzoic acid (PubChem CID 62230863) has the molecular formula C13H9F2NO2 and a molecular weight of 249.22 g/mol. Its IUPAC name is 4-(2,3-difluoroanilino)benzoic acid.
| Compound Name | 4-(2,3-difluoroanilino)benzoic acid |
|---|---|
| PubChem CID | 62230863 |
| Molecular Formula | C13H9F2NO2 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-(2,3-difluoroanilino)benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2cccc(F)c2F)cc1 |
| InChI | InChI=1S/C13H9F2NO2/c14-10-2-1-3-11(12(10)15)16-9-6-4-8(5-7-9)13(17)18/h1-7,16H,(H,17,18) |
| InChIKey | RKOBLJZXRDCVNV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |