4-(2,5-difluoroanilino)benzoic acid

C13H9F2NO2 — CID 62231203

IUPAC4-(2,5-difluoroanilino)benzoic acid
SMILESO=C(O)c1ccc(Nc2cc(F)ccc2F)cc1
InChIInChI=1S/C13H9F2NO2/c14-9-3-6-11(15)12(7-9)16-10-4-1-8(2-5-10)13(17)18/h1-7,16H,(H,17,18)
InChIKeyYEADNGMVTGPBIP-UHFFFAOYSA-N
MW249.22 g/mol
LogP3.41
Rot. Bonds3

About 4-(2,5-difluoroanilino)benzoic acid

4-(2,5-difluoroanilino)benzoic acid (PubChem CID 62231203) has the molecular formula C13H9F2NO2 and a molecular weight of 249.22 g/mol. Its IUPAC name is 4-(2,5-difluoroanilino)benzoic acid.

Molecular Properties

Compound Name4-(2,5-difluoroanilino)benzoic acid
PubChem CID62231203
Molecular FormulaC13H9F2NO2
Molecular Weight249.22 g/mol
Exact Mass249.06
IUPAC Name4-(2,5-difluoroanilino)benzoic acid
SMILESO=C(O)c1ccc(Nc2cc(F)ccc2F)cc1
InChIInChI=1S/C13H9F2NO2/c14-9-3-6-11(15)12(7-9)16-10-4-1-8(2-5-10)13(17)18/h1-7,16H,(H,17,18)
InChIKeyYEADNGMVTGPBIP-UHFFFAOYSA-N
XLogP3.41
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.22
LogP ≤ 53.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,5-difluoroanilino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-difluoroanilino)benzoic acid?
The IUPAC name of 4-(2,5-difluoroanilino)benzoic acid (CID 62231203) is 4-(2,5-difluoroanilino)benzoic acid.
What is the SMILES notation for 4-(2,5-difluoroanilino)benzoic acid?
The canonical SMILES for 4-(2,5-difluoroanilino)benzoic acid is O=C(O)c1ccc(Nc2cc(F)ccc2F)cc1.
What is the InChIKey of 4-(2,5-difluoroanilino)benzoic acid?
The InChIKey is YEADNGMVTGPBIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F2NO2/c14-9-3-6-11(15)12(7-9)16-10-4-1-8(2-5-10)13(17)18/h1-7,16H,(H,17,18).
What are the key properties of 4-(2,5-difluoroanilino)benzoic acid?
4-(2,5-difluoroanilino)benzoic acid has a molecular weight of 249.22 g/mol, XLogP of 3.41, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-difluoroanilino)benzoic acid is sourced from PubChem (CID 62231203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).