C12H8ClF2N — CID 82536926
N-(4-chlorophenyl)-2,5-difluoroaniline (PubChem CID 82536926) has the molecular formula C12H8ClF2N and a molecular weight of 239.65 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,5-difluoroaniline.
| Compound Name | N-(4-chlorophenyl)-2,5-difluoroaniline |
|---|---|
| PubChem CID | 82536926 |
| Molecular Formula | C12H8ClF2N |
| Molecular Weight | 239.65 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | N-(4-chlorophenyl)-2,5-difluoroaniline |
| SMILES | Fc1ccc(F)c(Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C12H8ClF2N/c13-8-1-4-10(5-2-8)16-12-7-9(14)3-6-11(12)15/h1-7,16H |
| InChIKey | NKCIKVLCCURMDF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |