C12H9F2NO — CID 82537391
2-(2,5-difluoroanilino)phenol (PubChem CID 82537391) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is 2-(2,5-difluoroanilino)phenol.
| Compound Name | 2-(2,5-difluoroanilino)phenol |
|---|---|
| PubChem CID | 82537391 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2-(2,5-difluoroanilino)phenol |
| SMILES | Oc1ccccc1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C12H9F2NO/c13-8-5-6-9(14)11(7-8)15-10-3-1-2-4-12(10)16/h1-7,15-16H |
| InChIKey | DFYUZPOQBFHLAW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|