C15H17F2N5O — CID 142468164
N'-[amino(2-hydroxyethyl)amino]-2-(2,5-difluoroanilino)benzenecarboximidamide (PubChem CID 142468164) has the molecular formula C15H17F2N5O and a molecular weight of 321.33 g/mol. Its IUPAC name is N'-[amino(2-hydroxyethyl)amino]-2-(2,5-difluoroanilino)benzenecarboximidamide.
| Compound Name | N'-[amino(2-hydroxyethyl)amino]-2-(2,5-difluoroanilino)benzenecarboximidamide |
|---|---|
| PubChem CID | 142468164 |
| Molecular Formula | C15H17F2N5O |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N'-[amino(2-hydroxyethyl)amino]-2-(2,5-difluoroanilino)benzenecarboximidamide |
| SMILES | N/C(=N\N(N)CCO)c1ccccc1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C15H17F2N5O/c16-10-5-6-12(17)14(9-10)20-13-4-2-1-3-11(13)15(18)21-22(19)7-8-23/h1-6,9,20,23H,7-8,19H2,(H2,18,21) |
| InChIKey | HVNXHSBTIHRDGI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|