C19H24F3N5OS — CID 142468067
N'-[amino(2-hydroxyethyl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide;thietane (PubChem CID 142468067) has the molecular formula C19H24F3N5OS and a molecular weight of 427.50 g/mol. Its IUPAC name is N'-[amino(2-hydroxyethyl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide;thietane.
| Compound Name | N'-[amino(2-hydroxyethyl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide;thietane |
|---|---|
| PubChem CID | 142468067 |
| Molecular Formula | C19H24F3N5OS |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N'-[amino(2-hydroxyethyl)amino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide;thietane |
| SMILES | C1CSC1.N/C(=N\N(N)CCO)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3N5O.C3H6S/c17-16(18,19)11-5-7-12(8-6-11)22-14-4-2-1-3-13(14)15(20)23-24(21)9-10-25;1-2-4-3-1/h1-8,22,25H,9-10,21H2,(H2,20,23);1-3H2 |
| InChIKey | CXIDSRFQYMZGRJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|