C17H19F3N6O — CID 142468369
2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-methylacetamide (PubChem CID 142468369) has the molecular formula C17H19F3N6O and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-methylacetamide.
| Compound Name | 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-methylacetamide |
|---|---|
| PubChem CID | 142468369 |
| Molecular Formula | C17H19F3N6O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-methylacetamide |
| SMILES | CNC(=O)CN(N)/N=C(\N)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H19F3N6O/c1-23-15(27)10-26(22)25-16(21)13-4-2-3-5-14(13)24-12-8-6-11(7-9-12)17(18,19)20/h2-9,24H,10,22H2,1H3,(H2,21,25)(H,23,27) |
| InChIKey | BZJXTVFYCYBOSD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|