C22H27F3N6O2 — CID 142468277
N'-[(1-acetyl-3-hydroxypiperidin-3-yl)methyl-aminoamino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142468277) has the molecular formula C22H27F3N6O2 and a molecular weight of 464.49 g/mol. Its IUPAC name is N'-[(1-acetyl-3-hydroxypiperidin-3-yl)methyl-aminoamino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | N'-[(1-acetyl-3-hydroxypiperidin-3-yl)methyl-aminoamino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468277 |
| Molecular Formula | C22H27F3N6O2 |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | N'-[(1-acetyl-3-hydroxypiperidin-3-yl)methyl-aminoamino]-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | CC(=O)N1CCCC(O)(CN(N)/N=C(\N)c2ccccc2Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C22H27F3N6O2/c1-15(32)30-12-4-11-21(33,13-30)14-31(27)29-20(26)18-5-2-3-6-19(18)28-17-9-7-16(8-10-17)22(23,24)25/h2-3,5-10,28,33H,4,11-14,27H2,1H3,(H2,26,29) |
| InChIKey | XAUOMVBVODYNHS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 120.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|