C18H22F3N5O — CID 142468007
N'-[amino(2-hydroxyethyl)amino]-5-ethyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide (PubChem CID 142468007) has the molecular formula C18H22F3N5O and a molecular weight of 381.40 g/mol. Its IUPAC name is N'-[amino(2-hydroxyethyl)amino]-5-ethyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide.
| Compound Name | N'-[amino(2-hydroxyethyl)amino]-5-ethyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142468007 |
| Molecular Formula | C18H22F3N5O |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N'-[amino(2-hydroxyethyl)amino]-5-ethyl-2-[4-(trifluoromethyl)anilino]benzenecarboximidamide |
| SMILES | CCc1ccc(Nc2ccc(C(F)(F)F)cc2)c(/C(N)=N/N(N)CCO)c1 |
| InChI | InChI=1S/C18H22F3N5O/c1-2-12-3-8-16(15(11-12)17(22)25-26(23)9-10-27)24-14-6-4-13(5-7-14)18(19,20)21/h3-8,11,24,27H,2,9-10,23H2,1H3,(H2,22,25) |
| InChIKey | SHONXCAQNYGNRN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|