C15H22F3NO — CID 62013930
2-[pentan-3-yl-[[4-(trifluoromethyl)phenyl]methyl]amino]ethanol (PubChem CID 62013930) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[pentan-3-yl-[[4-(trifluoromethyl)phenyl]methyl]amino]ethanol.
| Compound Name | 2-[pentan-3-yl-[[4-(trifluoromethyl)phenyl]methyl]amino]ethanol |
|---|---|
| PubChem CID | 62013930 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 2-[pentan-3-yl-[[4-(trifluoromethyl)phenyl]methyl]amino]ethanol |
| SMILES | CCC(CC)N(CCO)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3NO/c1-3-14(4-2)19(9-10-20)11-12-5-7-13(8-6-12)15(16,17)18/h5-8,14,20H,3-4,9-11H2,1-2H3 |
| InChIKey | IFSLEERPBQBGAT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |