C21H31F3N6O2 — CID 142468083
2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide;ethane;propane (PubChem CID 142468083) has the molecular formula C21H31F3N6O2 and a molecular weight of 456.51 g/mol. Its IUPAC name is 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide;ethane;propane.
| Compound Name | 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide;ethane;propane |
|---|---|
| PubChem CID | 142468083 |
| Molecular Formula | C21H31F3N6O2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]-N-hydroxyacetamide;ethane;propane |
| SMILES | CC.CCC.N/C(=N\N(N)CC(=O)NO)c1ccccc1Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H17F3N6O2.C3H8.C2H6/c17-16(18,19)10-5-7-11(8-6-10)22-13-4-2-1-3-12(13)15(20)23-25(21)9-14(26)24-27;1-3-2;1-2/h1-8,22,27H,9,21H2,(H2,20,23)(H,24,26);3H2,1-2H3;1-2H3 |
| InChIKey | XLJJBKGKTYFBMB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 129.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|