C23H29F3N6O2 — CID 142468292
tert-butyl 3-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]pyrrolidine-1-carboxylate (PubChem CID 142468292) has the molecular formula C23H29F3N6O2 and a molecular weight of 478.52 g/mol. Its IUPAC name is tert-butyl 3-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142468292 |
| Molecular Formula | C23H29F3N6O2 |
| Molecular Weight | 478.52 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | tert-butyl 3-[amino-[(Z)-[amino-[2-[4-(trifluoromethyl)anilino]phenyl]methylidene]amino]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N(N)/N=C(\N)c2ccccc2Nc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C23H29F3N6O2/c1-22(2,3)34-21(33)31-13-12-17(14-31)32(28)30-20(27)18-6-4-5-7-19(18)29-16-10-8-15(9-11-16)23(24,25)26/h4-11,17,29H,12-14,28H2,1-3H3,(H2,27,30) |
| InChIKey | CVLHVPVJTLTCIK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 109.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|